METHYL 3-KETOTETRADECANOATE
methyl 3-oxotetradecanoate
CAS: 22348-97-6
Molecular Formula: C15H28O3
METHYL 3-KETOTETRADECANOATE - Names and Identifiers
| Name | methyl 3-oxotetradecanoate |
| Synonyms | Methyl β-KetoMyristate Methyl b-ketomyristate methyl 3-oxotetradecanoate Methyl 3-oxotetradecanoate METHYL 3-OXOTETRADECANOATE METHYL 3-KETOTETRADECANOATE 3-Oxomyristic acid methyl ester 3-Ketomyristic acid methyl ester 3-Oxotetradecanoic acid methyl ester Tetradecanoic acid, 3-oxo-, methyl ester |
| CAS | 22348-97-6 |
| EINECS | 244-929-1 |
| InChI | InChI=1/C15H28O3/c1-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18-2/h3-13H2,1-2H3 |
METHYL 3-KETOTETRADECANOATE - Physico-chemical Properties
| Molecular Formula | C15H28O3 |
| Molar Mass | 256.38 |
| Density | 0.926±0.06 g/cm3(Predicted) |
| Melting Point | 29-30°C |
| Boling Point | 137-139 °C(Press: 0.9 Torr) |
| Flash Point | 121.5°C |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| Vapor Presure | 0.00139mmHg at 25°C |
| Appearance | Solid |
| Color | Light Yellow to Yellow Low-Melting |
| pKa | 10.65±0.46(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.442 |
METHYL 3-KETOTETRADECANOATE - Introduction
methyl 3-oxotetradecanoate, chemical formula C15H28O3, is an organic compound with the following properties:
1. Appearance: colorless to light yellow liquid.
2. Smell: with a light fruit flavor.
3. Melting Point: About -14 ° C.
4. Boiling point: About 133 ° C.
5. Density: about 0.90 g/cm.
6. Solubility: Soluble in ethanol, ether and most organic solvents.
The main uses of methyl 3-oxotetradecanoate include:
1. Spices: because of its fruit flavor, commonly used in food, cosmetics and perfume and other fields as a flavor ingredient.
2. Chemical Synthesis: as an intermediate in organic synthesis, it can be used to prepare other organic compounds, such as esters, ethers and ketones.
methyl 3-oxotetradecanoate is prepared as follows:
1. The lauric acid (lauric acid) and methanol reaction, while adding hydrochloric acid catalyst.
2. After esterification reaction, methyl 3-oxotetradecanoate is generated.
About safety information:
1. Toxicity: methyl 3-oxotetradecanoate low toxicity, but should avoid direct contact with the skin and inhalation to the respiratory tract.
2. Combustibility: methyl 3-oxotetradecanoate is a flammable liquid, avoiding fire and high temperature.
3. Chemical stability: relatively stable at room temperature, will not spontaneously decompose.
4. Storage requirements: should be stored in a cool, ventilated place, away from fire and oxidant.
When using methyl 3-oxotetradecanoate, you should follow the safety operation specifications and take reasonable protective measures according to the specific situation. If you encounter an accident or discomfort, you should seek medical attention immediately.
1. Appearance: colorless to light yellow liquid.
2. Smell: with a light fruit flavor.
3. Melting Point: About -14 ° C.
4. Boiling point: About 133 ° C.
5. Density: about 0.90 g/cm.
6. Solubility: Soluble in ethanol, ether and most organic solvents.
The main uses of methyl 3-oxotetradecanoate include:
1. Spices: because of its fruit flavor, commonly used in food, cosmetics and perfume and other fields as a flavor ingredient.
2. Chemical Synthesis: as an intermediate in organic synthesis, it can be used to prepare other organic compounds, such as esters, ethers and ketones.
methyl 3-oxotetradecanoate is prepared as follows:
1. The lauric acid (lauric acid) and methanol reaction, while adding hydrochloric acid catalyst.
2. After esterification reaction, methyl 3-oxotetradecanoate is generated.
About safety information:
1. Toxicity: methyl 3-oxotetradecanoate low toxicity, but should avoid direct contact with the skin and inhalation to the respiratory tract.
2. Combustibility: methyl 3-oxotetradecanoate is a flammable liquid, avoiding fire and high temperature.
3. Chemical stability: relatively stable at room temperature, will not spontaneously decompose.
4. Storage requirements: should be stored in a cool, ventilated place, away from fire and oxidant.
When using methyl 3-oxotetradecanoate, you should follow the safety operation specifications and take reasonable protective measures according to the specific situation. If you encounter an accident or discomfort, you should seek medical attention immediately.
Last Update：2024-04-09 20:00:08
Supplier List
Product Name: Methyl 3-Oxotetradecanoate Visit Supplier Webpage Request for quotation
CAS: 22348-97-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 22348-97-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Methyl 3-Oxotetradecanoate Visit Supplier Webpage Request for quotation
CAS: 22348-97-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 22348-97-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History